C30H34F4N4O6 — CID 166170003
N-(2,3-dimethylphenyl)-N'-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]oxamide (PubChem CID 166170003) has the molecular formula C30H34F4N4O6 and a molecular weight of 622.62 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N'-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]oxamide.
| Compound Name | N-(2,3-dimethylphenyl)-N'-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]oxamide |
|---|---|
| PubChem CID | 166170003 |
| Molecular Formula | C30H34F4N4O6 |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N'-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C[C@@H]2CCNC2=O)C(=O)COc2c(F)c(F)cc(F)c2F)c1C |
| InChI | InChI=1S/C30H34F4N4O6/c1-14(2)10-22(38-30(43)29(42)36-20-7-5-6-15(3)16(20)4)28(41)37-21(11-17-8-9-35-27(17)40)23(39)13-44-26-24(33)18(31)12-19(32)25(26)34/h5-7,12,14,17,21-22H,8-11,13H2,1-4H3,(H,35,40)(H,36,42)(H,37,41)(H,38,43)/t17-,21-,22-/m0/s1 |
| InChIKey | HDVXTQCPSJBCSQ-HSQYWUDLSA-N |
| XLogP | 2.99 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|