C22H30ClFN4O6 — CID 175537628
[7-chloro-5-[[2-[[2-(2-fluoroanilino)-2-oxoacetyl]amino]-4-methylpentanoyl]amino]-6-oxoheptyl] carbamate (PubChem CID 175537628) has the molecular formula C22H30ClFN4O6 and a molecular weight of 500.96 g/mol. Its IUPAC name is [7-chloro-5-[[2-[[2-(2-fluoroanilino)-2-oxoacetyl]amino]-4-methylpentanoyl]amino]-6-oxoheptyl] carbamate.
| Compound Name | [7-chloro-5-[[2-[[2-(2-fluoroanilino)-2-oxoacetyl]amino]-4-methylpentanoyl]amino]-6-oxoheptyl] carbamate |
|---|---|
| PubChem CID | 175537628 |
| Molecular Formula | C22H30ClFN4O6 |
| Molecular Weight | 500.96 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [7-chloro-5-[[2-[[2-(2-fluoroanilino)-2-oxoacetyl]amino]-4-methylpentanoyl]amino]-6-oxoheptyl] carbamate |
| SMILES | CC(C)CC(NC(=O)C(=O)Nc1ccccc1F)C(=O)NC(CCCCOC(N)=O)C(=O)CCl |
| InChI | InChI=1S/C22H30ClFN4O6/c1-13(2)11-17(28-21(32)20(31)26-15-8-4-3-7-14(15)24)19(30)27-16(18(29)12-23)9-5-6-10-34-22(25)33/h3-4,7-8,13,16-17H,5-6,9-12H2,1-2H3,(H2,25,33)(H,26,31)(H,27,30)(H,28,32) |
| InChIKey | BUIZGHSFIWIPMM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.96 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|