C18H36Cl2N4O3 — CID 172640178
N-(7-amino-1-chloro-2-oxoheptan-3-yl)-2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanamide;hydrochloride (PubChem CID 172640178) has the molecular formula C18H36Cl2N4O3 and a molecular weight of 427.42 g/mol. Its IUPAC name is N-(7-amino-1-chloro-2-oxoheptan-3-yl)-2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanamide;hydrochloride.
| Compound Name | N-(7-amino-1-chloro-2-oxoheptan-3-yl)-2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 172640178 |
| Molecular Formula | C18H36Cl2N4O3 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-(7-amino-1-chloro-2-oxoheptan-3-yl)-2-[(2-amino-3-methylbutanoyl)amino]-4-methylpentanamide;hydrochloride |
| SMILES | CC(C)CC(NC(=O)C(N)C(C)C)C(=O)NC(CCCCN)C(=O)CCl.Cl |
| InChI | InChI=1S/C18H35ClN4O3.ClH/c1-11(2)9-14(23-18(26)16(21)12(3)4)17(25)22-13(15(24)10-19)7-5-6-8-20;/h11-14,16H,5-10,20-21H2,1-4H3,(H,22,25)(H,23,26);1H |
| InChIKey | MLRAOFPMGDWEGF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|