C23H40N6O3 — CID 70557827
(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-N-(2-aminophenyl)hexanamide (PubChem CID 70557827) has the molecular formula C23H40N6O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-N-(2-aminophenyl)hexanamide.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-N-(2-aminophenyl)hexanamide |
|---|---|
| PubChem CID | 70557827 |
| Molecular Formula | C23H40N6O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-N-(2-aminophenyl)hexanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](N)C(C)C)C(=O)N[C@@H](CCCCN)C(=O)Nc1ccccc1N |
| InChI | InChI=1S/C23H40N6O3/c1-14(2)13-19(29-23(32)20(26)15(3)4)22(31)28-18(11-7-8-12-24)21(30)27-17-10-6-5-9-16(17)25/h5-6,9-10,14-15,18-20H,7-8,11-13,24-26H2,1-4H3,(H,27,30)(H,28,31)(H,29,32)/t18-,19-,20+/m0/s1 |
| InChIKey | OAKQHKLRLATNHK-SLFFLAALSA-N |
| XLogP | 1.34 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|