C31H48Cl2F6N6O7 — CID 131885814
(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-N-[4-[bis(2-chloroethyl)amino]phenyl]hexanamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 131885814) has the molecular formula C31H48Cl2F6N6O7 and a molecular weight of 801.65 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-N-[4-[bis(2-chloroethyl)amino]phenyl]hexanamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-N-[4-[bis(2-chloroethyl)amino]phenyl]hexanamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 131885814 |
| Molecular Formula | C31H48Cl2F6N6O7 |
| Molecular Weight | 801.65 g/mol |
| Exact Mass | 800.29 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-N-[4-[bis(2-chloroethyl)amino]phenyl]hexanamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](N)C(C)C)C(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(N(CCCl)CCCl)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H46Cl2N6O3.2C2HF3O2/c1-18(2)17-23(34-27(38)24(31)19(3)4)26(37)33-22(7-5-6-14-30)25(36)32-20-8-10-21(11-9-20)35(15-12-28)16-13-29;2*3-2(4,5)1(6)7/h8-11,18-19,22-24H,5-7,12-17,30-31H2,1-4H3,(H,32,36)(H,33,37)(H,34,38);2*(H,6,7)/t22-,23-,24+;;/m0../s1 |
| InChIKey | QRKXYRPSZITIEH-FHBUWTGASA-N |
| XLogP | 4.30 |
| TPSA | 217.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|