C30H54Cl2N6O5 — CID 70522790
4-[4-[[(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]amino]-N-propylanilino]butanoic acid;dihydrochloride (PubChem CID 70522790) has the molecular formula C30H54Cl2N6O5 and a molecular weight of 649.71 g/mol. Its IUPAC name is 4-[4-[[(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]amino]-N-propylanilino]butanoic acid;dihydrochloride.
| Compound Name | 4-[4-[[(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]amino]-N-propylanilino]butanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 70522790 |
| Molecular Formula | C30H54Cl2N6O5 |
| Molecular Weight | 649.71 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | 4-[4-[[(2S)-6-amino-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]amino]-N-propylanilino]butanoic acid;dihydrochloride |
| SMILES | CCCN(CCCC(=O)O)c1ccc(NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](N)C(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C30H52N6O5.2ClH/c1-6-17-36(18-9-11-26(37)38)23-14-12-22(13-15-23)33-28(39)24(10-7-8-16-31)34-29(40)25(19-20(2)3)35-30(41)27(32)21(4)5;;/h12-15,20-21,24-25,27H,6-11,16-19,31-32H2,1-5H3,(H,33,39)(H,34,40)(H,35,41)(H,37,38);2*1H/t24-,25-,27+;;/m0../s1 |
| InChIKey | YPFGPVQWHKHOEV-JRRIUJKTSA-N |
| XLogP | 3.68 |
| TPSA | 179.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.71 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|