C14H21N3O3 — CID 91260086
[(2S)-6-amino-1-(2-methylanilino)-1-oxohexan-2-yl]carbamic acid (PubChem CID 91260086) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(2S)-6-amino-1-(2-methylanilino)-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [(2S)-6-amino-1-(2-methylanilino)-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 91260086 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | [(2S)-6-amino-1-(2-methylanilino)-1-oxohexan-2-yl]carbamic acid |
| SMILES | Cc1ccccc1NC(=O)[C@H](CCCCN)NC(=O)O |
| InChI | InChI=1S/C14H21N3O3/c1-10-6-2-3-7-11(10)16-13(18)12(17-14(19)20)8-4-5-9-15/h2-3,6-7,12,17H,4-5,8-9,15H2,1H3,(H,16,18)(H,19,20)/t12-/m0/s1 |
| InChIKey | KSMWYHPNOOXREG-LBPRGKRZSA-N |
| XLogP | 1.70 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|