C15H22N4O4 — CID 91314159
[1-(N-acetamidoanilino)-6-amino-1-oxohexan-2-yl]carbamic acid (PubChem CID 91314159) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is [1-(N-acetamidoanilino)-6-amino-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [1-(N-acetamidoanilino)-6-amino-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 91314159 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [1-(N-acetamidoanilino)-6-amino-1-oxohexan-2-yl]carbamic acid |
| SMILES | CC(=O)NN(C(=O)C(CCCCN)NC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H22N4O4/c1-11(20)18-19(12-7-3-2-4-8-12)14(21)13(17-15(22)23)9-5-6-10-16/h2-4,7-8,13,17H,5-6,9-10,16H2,1H3,(H,18,20)(H,22,23) |
| InChIKey | VSUCEWPZSCUKHS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|