C14H26N4O7 — CID 57143995
[(2S)-6-amino-1-[(2S)-6-amino-2-(carboxyamino)hexanoyl]oxy-1-oxohexan-2-yl]carbamic acid (PubChem CID 57143995) has the molecular formula C14H26N4O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(2S)-6-amino-1-[(2S)-6-amino-2-(carboxyamino)hexanoyl]oxy-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [(2S)-6-amino-1-[(2S)-6-amino-2-(carboxyamino)hexanoyl]oxy-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 57143995 |
| Molecular Formula | C14H26N4O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [(2S)-6-amino-1-[(2S)-6-amino-2-(carboxyamino)hexanoyl]oxy-1-oxohexan-2-yl]carbamic acid |
| SMILES | NCCCC[C@H](NC(=O)O)C(=O)OC(=O)[C@H](CCCCN)NC(=O)O |
| InChI | InChI=1S/C14H26N4O7/c15-7-3-1-5-9(17-13(21)22)11(19)25-12(20)10(18-14(23)24)6-2-4-8-16/h9-10,17-18H,1-8,15-16H2,(H,21,22)(H,23,24)/t9-,10-/m0/s1 |
| InChIKey | SDYPRBYZIXRWDU-UWVGGRQHSA-N |
| XLogP | -0.41 |
| TPSA | 194.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|