C19H28ClN3O5 — CID 53471676
(2S)-2-[[(2S)-2-(N-acetylanilino)propanoyl]amino]-6-aminohexanoic acid;acetyl chloride (PubChem CID 53471676) has the molecular formula C19H28ClN3O5 and a molecular weight of 413.90 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(N-acetylanilino)propanoyl]amino]-6-aminohexanoic acid;acetyl chloride.
| Compound Name | (2S)-2-[[(2S)-2-(N-acetylanilino)propanoyl]amino]-6-aminohexanoic acid;acetyl chloride |
|---|---|
| PubChem CID | 53471676 |
| Molecular Formula | C19H28ClN3O5 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-(N-acetylanilino)propanoyl]amino]-6-aminohexanoic acid;acetyl chloride |
| SMILES | CC(=O)Cl.CC(=O)N(c1ccccc1)[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C17H25N3O4.C2H3ClO/c1-12(20(13(2)21)14-8-4-3-5-9-14)16(22)19-15(17(23)24)10-6-7-11-18;1-2(3)4/h3-5,8-9,12,15H,6-7,10-11,18H2,1-2H3,(H,19,22)(H,23,24);1H3/t12-,15-;/m0./s1 |
| InChIKey | OYZLSUBFCQJOFC-NXCSSKFKSA-N |
| XLogP | 1.90 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|