C18H27N5O5 — CID 142697480
(2S)-2-[[(2S)-2-(N-[(2R)-2-aminopropanoyl]anilino)propanoyl]amino]-5-(carbamoylamino)pentanoic acid (PubChem CID 142697480) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(N-[(2R)-2-aminopropanoyl]anilino)propanoyl]amino]-5-(carbamoylamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(N-[(2R)-2-aminopropanoyl]anilino)propanoyl]amino]-5-(carbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 142697480 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-(N-[(2R)-2-aminopropanoyl]anilino)propanoyl]amino]-5-(carbamoylamino)pentanoic acid |
| SMILES | C[C@@H](N)C(=O)N(c1ccccc1)[C@@H](C)C(=O)N[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C18H27N5O5/c1-11(19)16(25)23(13-7-4-3-5-8-13)12(2)15(24)22-14(17(26)27)9-6-10-21-18(20)28/h3-5,7-8,11-12,14H,6,9-10,19H2,1-2H3,(H,22,24)(H,26,27)(H3,20,21,28)/t11-,12+,14+/m1/s1 |
| InChIKey | NUAOXXGXNAVNCV-DYEKYZERSA-N |
| XLogP | -0.23 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|