C26H44N10O5S — CID 174496325
2-[2-(N-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]anilino)propanoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 174496325) has the molecular formula C26H44N10O5S and a molecular weight of 608.77 g/mol. Its IUPAC name is 2-[2-(N-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]anilino)propanoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[2-(N-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]anilino)propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 174496325 |
| Molecular Formula | C26H44N10O5S |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | 2-[2-(N-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]anilino)propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)N(c1ccccc1)C(C)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H44N10O5S/c1-16(21(37)35-20(24(40)41)11-7-14-33-26(30)31)36(17-8-4-3-5-9-17)23(39)19(10-6-13-32-25(28)29)34-22(38)18(27)12-15-42-2/h3-5,8-9,16,18-20H,6-7,10-15,27H2,1-2H3,(H,34,38)(H,35,37)(H,40,41)(H4,28,29,32)(H4,30,31,33) |
| InChIKey | WWCWILVCYYEXEX-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 270.63 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|