C21H30N4O7 — CID 11123224
(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-6-aminohexanoic acid (PubChem CID 11123224) has the molecular formula C21H30N4O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-6-aminohexanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-6-aminohexanoic acid |
|---|---|
| PubChem CID | 11123224 |
| Molecular Formula | C21H30N4O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-3-phenylpropanoyl]amino]-6-aminohexanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C21H30N4O7/c1-13(26)23-17(12-18(27)28)20(30)25-16(11-14-7-3-2-4-8-14)19(29)24-15(21(31)32)9-5-6-10-22/h2-4,7-8,15-17H,5-6,9-12,22H2,1H3,(H,23,26)(H,24,29)(H,25,30)(H,27,28)(H,31,32)/t15-,16-,17-/m0/s1 |
| InChIKey | ZFJDCVRIJAHVNT-ULQDDVLXSA-N |
| XLogP | -0.61 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|