C26H29N3O2 — CID 91127715
N-[(2S)-6-amino-1-(4-methylanilino)-1-oxohexan-2-yl]-2-phenylbenzamide (PubChem CID 91127715) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-(4-methylanilino)-1-oxohexan-2-yl]-2-phenylbenzamide.
| Compound Name | N-[(2S)-6-amino-1-(4-methylanilino)-1-oxohexan-2-yl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 91127715 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[(2S)-6-amino-1-(4-methylanilino)-1-oxohexan-2-yl]-2-phenylbenzamide |
| SMILES | Cc1ccc(NC(=O)[C@H](CCCCN)NC(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29N3O2/c1-19-14-16-21(17-15-19)28-26(31)24(13-7-8-18-27)29-25(30)23-12-6-5-11-22(23)20-9-3-2-4-10-20/h2-6,9-12,14-17,24H,7-8,13,18,27H2,1H3,(H,28,31)(H,29,30)/t24-/m0/s1 |
| InChIKey | OXRCEOSPDOAXME-DEOSSOPVSA-N |
| XLogP | 4.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|