C27H30N4O4 — CID 10151955
4-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-N-(3-hydroxyphenyl)-2-phenylbenzamide (PubChem CID 10151955) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 4-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-N-(3-hydroxyphenyl)-2-phenylbenzamide.
| Compound Name | 4-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-N-(3-hydroxyphenyl)-2-phenylbenzamide |
|---|---|
| PubChem CID | 10151955 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 4-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-N-(3-hydroxyphenyl)-2-phenylbenzamide |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(C(=O)Nc2cccc(O)c2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H30N4O4/c1-18(32)29-25(12-5-6-15-28)27(35)31-21-13-14-23(24(17-21)19-8-3-2-4-9-19)26(34)30-20-10-7-11-22(33)16-20/h2-4,7-11,13-14,16-17,25,33H,5-6,12,15,28H2,1H3,(H,29,32)(H,30,34)(H,31,35)/t25-/m0/s1 |
| InChIKey | RINAWAFYNNFHHX-VWLOTQADSA-N |
| XLogP | 3.88 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|