C28H30N4O5 — CID 10239207
2-[[4-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-2-phenylbenzoyl]amino]benzoic acid (PubChem CID 10239207) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is 2-[[4-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-2-phenylbenzoyl]amino]benzoic acid.
| Compound Name | 2-[[4-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-2-phenylbenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10239207 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-[[4-[[(2S)-2-acetamido-6-aminohexanoyl]amino]-2-phenylbenzoyl]amino]benzoic acid |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(C(=O)Nc2ccccc2C(=O)O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H30N4O5/c1-18(33)30-25(13-7-8-16-29)27(35)31-20-14-15-21(23(17-20)19-9-3-2-4-10-19)26(34)32-24-12-6-5-11-22(24)28(36)37/h2-6,9-12,14-15,17,25H,7-8,13,16,29H2,1H3,(H,30,33)(H,31,35)(H,32,34)(H,36,37)/t25-/m0/s1 |
| InChIKey | LRCTVKCBQRORGW-VWLOTQADSA-N |
| XLogP | 3.88 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|