C27H31FN4O3 — CID 91429377
(2S)-6-amino-2-[[4-[(2-fluorophenyl)methoxy]phenyl]carbamoylamino]-N-(4-methylphenyl)hexanamide (PubChem CID 91429377) has the molecular formula C27H31FN4O3 and a molecular weight of 478.57 g/mol. Its IUPAC name is (2S)-6-amino-2-[[4-[(2-fluorophenyl)methoxy]phenyl]carbamoylamino]-N-(4-methylphenyl)hexanamide.
| Compound Name | (2S)-6-amino-2-[[4-[(2-fluorophenyl)methoxy]phenyl]carbamoylamino]-N-(4-methylphenyl)hexanamide |
|---|---|
| PubChem CID | 91429377 |
| Molecular Formula | C27H31FN4O3 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (2S)-6-amino-2-[[4-[(2-fluorophenyl)methoxy]phenyl]carbamoylamino]-N-(4-methylphenyl)hexanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](CCCCN)NC(=O)Nc2ccc(OCc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C27H31FN4O3/c1-19-9-11-21(12-10-19)30-26(33)25(8-4-5-17-29)32-27(34)31-22-13-15-23(16-14-22)35-18-20-6-2-3-7-24(20)28/h2-3,6-7,9-16,25H,4-5,8,17-18,29H2,1H3,(H,30,33)(H2,31,32,34)/t25-/m0/s1 |
| InChIKey | KIQVJRFGZOUTNA-VWLOTQADSA-N |
| XLogP | 4.97 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|