C29H32N6O3 — CID 91493677
(2S)-6-amino-N-(4-imidazol-1-ylphenyl)-2-[(4-phenylmethoxyphenyl)carbamoylamino]hexanamide (PubChem CID 91493677) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is (2S)-6-amino-N-(4-imidazol-1-ylphenyl)-2-[(4-phenylmethoxyphenyl)carbamoylamino]hexanamide.
| Compound Name | (2S)-6-amino-N-(4-imidazol-1-ylphenyl)-2-[(4-phenylmethoxyphenyl)carbamoylamino]hexanamide |
|---|---|
| PubChem CID | 91493677 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (2S)-6-amino-N-(4-imidazol-1-ylphenyl)-2-[(4-phenylmethoxyphenyl)carbamoylamino]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)Nc1ccc(OCc2ccccc2)cc1)C(=O)Nc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C29H32N6O3/c30-17-5-4-8-27(28(36)32-23-9-13-25(14-10-23)35-19-18-31-21-35)34-29(37)33-24-11-15-26(16-12-24)38-20-22-6-2-1-3-7-22/h1-3,6-7,9-16,18-19,21,27H,4-5,8,17,20,30H2,(H,32,36)(H2,33,34,37)/t27-/m0/s1 |
| InChIKey | FTFZJAAASNXNTJ-MHZLTWQESA-N |
| XLogP | 4.71 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|