C20H24FN3O4 — CID 149432585
(2S)-6-amino-2-[[4-[(3-fluorophenyl)methoxy]phenyl]carbamoylamino]hexanoic acid (PubChem CID 149432585) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is (2S)-6-amino-2-[[4-[(3-fluorophenyl)methoxy]phenyl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[4-[(3-fluorophenyl)methoxy]phenyl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 149432585 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2S)-6-amino-2-[[4-[(3-fluorophenyl)methoxy]phenyl]carbamoylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)Nc1ccc(OCc2cccc(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H24FN3O4/c21-15-5-3-4-14(12-15)13-28-17-9-7-16(8-10-17)23-20(27)24-18(19(25)26)6-1-2-11-22/h3-5,7-10,12,18H,1-2,6,11,13,22H2,(H,25,26)(H2,23,24,27)/t18-/m0/s1 |
| InChIKey | CXLSJADBZAAGRQ-SFHVURJKSA-N |
| XLogP | 3.11 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|