C15H22FN3O3 — CID 69169193
6-amino-2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]hexanoic acid (PubChem CID 69169193) has the molecular formula C15H22FN3O3 and a molecular weight of 311.36 g/mol. Its IUPAC name is 6-amino-2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 69169193 |
| Molecular Formula | C15H22FN3O3 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 6-amino-2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CNCc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C15H22FN3O3/c16-12-5-3-4-11(8-12)9-18-10-14(20)19-13(15(21)22)6-1-2-7-17/h3-5,8,13,18H,1-2,6-7,9-10,17H2,(H,19,20)(H,21,22) |
| InChIKey | IPZCEPDCVLWQMC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|