C14H20ClN3O3 — CID 69230374
(2S)-6-amino-2-[[2-(3-chloroanilino)acetyl]amino]hexanoic acid (PubChem CID 69230374) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.78 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-(3-chloroanilino)acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-(3-chloroanilino)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 69230374 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (2S)-6-amino-2-[[2-(3-chloroanilino)acetyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CNc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C14H20ClN3O3/c15-10-4-3-5-11(8-10)17-9-13(19)18-12(14(20)21)6-1-2-7-16/h3-5,8,12,17H,1-2,6-7,9,16H2,(H,18,19)(H,20,21)/t12-/m0/s1 |
| InChIKey | JPEBHGPCOZHHCX-LBPRGKRZSA-N |
| XLogP | 1.45 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|