C18H22N2O3 — CID 154945512
6-amino-2-[(2-naphthalen-1-ylacetyl)amino]hexanoic acid (PubChem CID 154945512) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 6-amino-2-[(2-naphthalen-1-ylacetyl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[(2-naphthalen-1-ylacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 154945512 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 6-amino-2-[(2-naphthalen-1-ylacetyl)amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)Cc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H22N2O3/c19-11-4-3-10-16(18(22)23)20-17(21)12-14-8-5-7-13-6-1-2-9-15(13)14/h1-2,5-9,16H,3-4,10-12,19H2,(H,20,21)(H,22,23) |
| InChIKey | LOZYGAGAWBAASJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|