C16H21N3O3 — CID 57285552
(2S)-6-amino-2-[[2-(1H-indol-3-yl)acetyl]amino]hexanoic acid (PubChem CID 57285552) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-(1H-indol-3-yl)acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-(1H-indol-3-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 57285552 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2S)-6-amino-2-[[2-(1H-indol-3-yl)acetyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H21N3O3/c17-8-4-3-7-14(16(21)22)19-15(20)9-11-10-18-13-6-2-1-5-12(11)13/h1-2,5-6,10,14,18H,3-4,7-9,17H2,(H,19,20)(H,21,22)/t14-/m0/s1 |
| InChIKey | SQZYPHUMAASLBA-AWEZNQCLSA-N |
| XLogP | 1.41 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|