C20H25N3O4 — CID 69167382
(2S)-6-amino-2-[(3-phenylmethoxyphenyl)carbamoylamino]hexanoic acid (PubChem CID 69167382) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (2S)-6-amino-2-[(3-phenylmethoxyphenyl)carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(3-phenylmethoxyphenyl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 69167382 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2S)-6-amino-2-[(3-phenylmethoxyphenyl)carbamoylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)Nc1cccc(OCc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C20H25N3O4/c21-12-5-4-11-18(19(24)25)23-20(26)22-16-9-6-10-17(13-16)27-14-15-7-2-1-3-8-15/h1-3,6-10,13,18H,4-5,11-12,14,21H2,(H,24,25)(H2,22,23,26)/t18-/m0/s1 |
| InChIKey | SPMPZGYZPVFHOS-SFHVURJKSA-N |
| XLogP | 2.97 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|