C20H23F2N3O4 — CID 69109748
6-amino-2-[[4-[(3,5-difluorophenyl)methoxy]phenyl]carbamoylamino]hexanoic acid (PubChem CID 69109748) has the molecular formula C20H23F2N3O4 and a molecular weight of 407.42 g/mol. Its IUPAC name is 6-amino-2-[[4-[(3,5-difluorophenyl)methoxy]phenyl]carbamoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[[4-[(3,5-difluorophenyl)methoxy]phenyl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 69109748 |
| Molecular Formula | C20H23F2N3O4 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 6-amino-2-[[4-[(3,5-difluorophenyl)methoxy]phenyl]carbamoylamino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)Nc1ccc(OCc2cc(F)cc(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H23F2N3O4/c21-14-9-13(10-15(22)11-14)12-29-17-6-4-16(5-7-17)24-20(28)25-18(19(26)27)3-1-2-8-23/h4-7,9-11,18H,1-3,8,12,23H2,(H,26,27)(H2,24,25,28) |
| InChIKey | GAMQIMNJFJKJPV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|