C23H26ClN3O5 — CID 139676222
(2S)-6-amino-2-[[5-(4-phenylmethoxyphenyl)-1,2-oxazole-3-carbonyl]amino]hexanoic acid;hydrochloride (PubChem CID 139676222) has the molecular formula C23H26ClN3O5 and a molecular weight of 459.93 g/mol. Its IUPAC name is (2S)-6-amino-2-[[5-(4-phenylmethoxyphenyl)-1,2-oxazole-3-carbonyl]amino]hexanoic acid;hydrochloride.
| Compound Name | (2S)-6-amino-2-[[5-(4-phenylmethoxyphenyl)-1,2-oxazole-3-carbonyl]amino]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 139676222 |
| Molecular Formula | C23H26ClN3O5 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (2S)-6-amino-2-[[5-(4-phenylmethoxyphenyl)-1,2-oxazole-3-carbonyl]amino]hexanoic acid;hydrochloride |
| SMILES | Cl.NCCCC[C@H](NC(=O)c1cc(-c2ccc(OCc3ccccc3)cc2)on1)C(=O)O |
| InChI | InChI=1S/C23H25N3O5.ClH/c24-13-5-4-8-19(23(28)29)25-22(27)20-14-21(31-26-20)17-9-11-18(12-10-17)30-15-16-6-2-1-3-7-16;/h1-3,6-7,9-12,14,19H,4-5,8,13,15,24H2,(H,25,27)(H,28,29);1H/t19-;/m0./s1 |
| InChIKey | YHDKOHDBXQMNQB-FYZYNONXSA-N |
| XLogP | 3.65 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|