C17H22ClN3O5 — CID 139676212
(2S)-6-amino-2-[[5-(4-methoxyphenyl)-1,2-oxazole-3-carbonyl]amino]hexanoic acid;hydrochloride (PubChem CID 139676212) has the molecular formula C17H22ClN3O5 and a molecular weight of 383.83 g/mol. Its IUPAC name is (2S)-6-amino-2-[[5-(4-methoxyphenyl)-1,2-oxazole-3-carbonyl]amino]hexanoic acid;hydrochloride.
| Compound Name | (2S)-6-amino-2-[[5-(4-methoxyphenyl)-1,2-oxazole-3-carbonyl]amino]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 139676212 |
| Molecular Formula | C17H22ClN3O5 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (2S)-6-amino-2-[[5-(4-methoxyphenyl)-1,2-oxazole-3-carbonyl]amino]hexanoic acid;hydrochloride |
| SMILES | COc1ccc(-c2cc(C(=O)N[C@@H](CCCCN)C(=O)O)no2)cc1.Cl |
| InChI | InChI=1S/C17H21N3O5.ClH/c1-24-12-7-5-11(6-8-12)15-10-14(20-25-15)16(21)19-13(17(22)23)4-2-3-9-18;/h5-8,10,13H,2-4,9,18H2,1H3,(H,19,21)(H,22,23);1H/t13-;/m0./s1 |
| InChIKey | MDWVZVTVIIYDOJ-ZOWNYOTGSA-N |
| XLogP | 2.08 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|