C11H8ClNO3 — CID 43840572
5-(4-methoxyphenyl)-1,2-oxazole-3-carbonyl chloride (PubChem CID 43840572) has the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1,2-oxazole-3-carbonyl chloride.
| Compound Name | 5-(4-methoxyphenyl)-1,2-oxazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 43840572 |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 5-(4-methoxyphenyl)-1,2-oxazole-3-carbonyl chloride |
| SMILES | COc1ccc(-c2cc(C(=O)Cl)no2)cc1 |
| InChI | InChI=1S/C11H8ClNO3/c1-15-8-4-2-7(3-5-8)10-6-9(11(12)14)13-16-10/h2-6H,1H3 |
| InChIKey | RRRPKKSNNMBCFW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|