C17H12BrNO4 — CID 17011718
(2-bromophenyl) 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylate (PubChem CID 17011718) has the molecular formula C17H12BrNO4 and a molecular weight of 374.19 g/mol. Its IUPAC name is (2-bromophenyl) 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | (2-bromophenyl) 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 17011718 |
| Molecular Formula | C17H12BrNO4 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | (2-bromophenyl) 5-(4-methoxyphenyl)-1,2-oxazole-3-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)Oc3ccccc3Br)no2)cc1 |
| InChI | InChI=1S/C17H12BrNO4/c1-21-12-8-6-11(7-9-12)16-10-14(19-23-16)17(20)22-15-5-3-2-4-13(15)18/h2-10H,1H3 |
| InChIKey | HNXFZFBVFOYUCN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|