C30H22N2O4 — CID 56971064
[2-methoxy-5-[(4-phenylphenyl)iminomethyl]phenyl] 5-phenyl-1,2-oxazole-3-carboxylate (PubChem CID 56971064) has the molecular formula C30H22N2O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is [2-methoxy-5-[(4-phenylphenyl)iminomethyl]phenyl] 5-phenyl-1,2-oxazole-3-carboxylate.
| Compound Name | [2-methoxy-5-[(4-phenylphenyl)iminomethyl]phenyl] 5-phenyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 56971064 |
| Molecular Formula | C30H22N2O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [2-methoxy-5-[(4-phenylphenyl)iminomethyl]phenyl] 5-phenyl-1,2-oxazole-3-carboxylate |
| SMILES | COc1ccc(/C=N/c2ccc(-c3ccccc3)cc2)cc1OC(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C30H22N2O4/c1-34-27-17-12-21(20-31-25-15-13-23(14-16-25)22-8-4-2-5-9-22)18-29(27)35-30(33)26-19-28(36-32-26)24-10-6-3-7-11-24/h2-20H,1H3/b31-20+ |
| InChIKey | FFFZWEQXPBWBBJ-AJBULDERSA-N |
| XLogP | 6.99 |
| TPSA | 73.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|