C15H11NO4S — CID 17011461
(4-methoxyphenyl) 5-thiophen-2-yl-1,2-oxazole-3-carboxylate (PubChem CID 17011461) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is (4-methoxyphenyl) 5-thiophen-2-yl-1,2-oxazole-3-carboxylate.
| Compound Name | (4-methoxyphenyl) 5-thiophen-2-yl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 17011461 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (4-methoxyphenyl) 5-thiophen-2-yl-1,2-oxazole-3-carboxylate |
| SMILES | COc1ccc(OC(=O)c2cc(-c3cccs3)on2)cc1 |
| InChI | InChI=1S/C15H11NO4S/c1-18-10-4-6-11(7-5-10)19-15(17)12-9-13(20-16-12)14-3-2-8-21-14/h2-9H,1H3 |
| InChIKey | JJNSIBWSLWTYKV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|