C18H11FN2O3S — CID 24592479
(4-fluorophenyl) 3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 24592479) has the molecular formula C18H11FN2O3S and a molecular weight of 354.36 g/mol. Its IUPAC name is (4-fluorophenyl) 3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | (4-fluorophenyl) 3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 24592479 |
| Molecular Formula | C18H11FN2O3S |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (4-fluorophenyl) 3-methyl-6-thiophen-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1noc2nc(-c3cccs3)cc(C(=O)Oc3ccc(F)cc3)c12 |
| InChI | InChI=1S/C18H11FN2O3S/c1-10-16-13(18(22)23-12-6-4-11(19)5-7-12)9-14(15-3-2-8-25-15)20-17(16)24-21-10/h2-9H,1H3 |
| InChIKey | HFYGNZXTJORJHK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|