C18H20ClN3O4 — CID 139676277
(2S)-6-amino-2-(benzo[g][1,2]benzoxazole-3-carbonylamino)hexanoic acid;hydrochloride (PubChem CID 139676277) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is (2S)-6-amino-2-(benzo[g][1,2]benzoxazole-3-carbonylamino)hexanoic acid;hydrochloride.
| Compound Name | (2S)-6-amino-2-(benzo[g][1,2]benzoxazole-3-carbonylamino)hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 139676277 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (2S)-6-amino-2-(benzo[g][1,2]benzoxazole-3-carbonylamino)hexanoic acid;hydrochloride |
| SMILES | Cl.NCCCC[C@H](NC(=O)c1noc2c1ccc1ccccc12)C(=O)O |
| InChI | InChI=1S/C18H19N3O4.ClH/c19-10-4-3-7-14(18(23)24)20-17(22)15-13-9-8-11-5-1-2-6-12(11)16(13)25-21-15;/h1-2,5-6,8-9,14H,3-4,7,10,19H2,(H,20,22)(H,23,24);1H/t14-;/m0./s1 |
| InChIKey | HZCMRBSEHOBKSO-UQKRIMTDSA-N |
| XLogP | 2.71 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|