C25H29N3O3 — CID 91451384
N-[(2S)-6-amino-1-(4-methylanilino)-1-oxohexan-2-yl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 91451384) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-(4-methylanilino)-1-oxohexan-2-yl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(2S)-6-amino-1-(4-methylanilino)-1-oxohexan-2-yl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 91451384 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[(2S)-6-amino-1-(4-methylanilino)-1-oxohexan-2-yl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-17-10-12-20(13-11-17)27-25(30)22(9-5-6-14-26)28-24(29)21-15-18-7-3-4-8-19(18)16-23(21)31-2/h3-4,7-8,10-13,15-16,22H,5-6,9,14,26H2,1-2H3,(H,27,30)(H,28,29)/t22-/m0/s1 |
| InChIKey | TVURPPURGOTSNO-QFIPXVFZSA-N |
| XLogP | 4.02 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|