C35H37F4N3O8 — CID 87134472
tert-butyl 3-[[3-methyl-2-[[2-oxo-2-(4-phenylmethoxyanilino)acetyl]amino]butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 87134472) has the molecular formula C35H37F4N3O8 and a molecular weight of 703.69 g/mol. Its IUPAC name is tert-butyl 3-[[3-methyl-2-[[2-oxo-2-(4-phenylmethoxyanilino)acetyl]amino]butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl 3-[[3-methyl-2-[[2-oxo-2-(4-phenylmethoxyanilino)acetyl]amino]butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 87134472 |
| Molecular Formula | C35H37F4N3O8 |
| Molecular Weight | 703.69 g/mol |
| Exact Mass | 703.25 |
| IUPAC Name | tert-butyl 3-[[3-methyl-2-[[2-oxo-2-(4-phenylmethoxyanilino)acetyl]amino]butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)C(NC(=O)C(=O)Nc1ccc(OCc2ccccc2)cc1)C(=O)NC(CC(=O)OC(C)(C)C)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C35H37F4N3O8/c1-19(2)30(42-34(47)33(46)40-21-11-13-22(14-12-21)48-17-20-9-7-6-8-10-20)32(45)41-25(16-27(44)50-35(3,4)5)26(43)18-49-31-28(38)23(36)15-24(37)29(31)39/h6-15,19,25,30H,16-18H2,1-5H3,(H,40,46)(H,41,45)(H,42,47) |
| InChIKey | LSJJGDCRAQLQKI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|