C14H18N2O — CID 113204328
1,3-dimethyl-N-propan-2-ylindole-2-carboxamide (PubChem CID 113204328) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1,3-dimethyl-N-propan-2-ylindole-2-carboxamide.
| Compound Name | 1,3-dimethyl-N-propan-2-ylindole-2-carboxamide |
|---|---|
| PubChem CID | 113204328 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1,3-dimethyl-N-propan-2-ylindole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)C)n(C)c2ccccc12 |
| InChI | InChI=1S/C14H18N2O/c1-9(2)15-14(17)13-10(3)11-7-5-6-8-12(11)16(13)4/h5-9H,1-4H3,(H,15,17) |
| InChIKey | SITBCBSVHMGREI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|