C19H20N2O — CID 113204429
N-(4-ethylphenyl)-1,3-dimethylindole-2-carboxamide (PubChem CID 113204429) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1,3-dimethylindole-2-carboxamide.
| Compound Name | N-(4-ethylphenyl)-1,3-dimethylindole-2-carboxamide |
|---|---|
| PubChem CID | 113204429 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(4-ethylphenyl)-1,3-dimethylindole-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2c(C)c3ccccc3n2C)cc1 |
| InChI | InChI=1S/C19H20N2O/c1-4-14-9-11-15(12-10-14)20-19(22)18-13(2)16-7-5-6-8-17(16)21(18)3/h5-12H,4H2,1-3H3,(H,20,22) |
| InChIKey | ULWISYXAWNWOKR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|