C20H17N3O — CID 113204473
1,3-dimethyl-N-quinolin-8-ylindole-2-carboxamide (PubChem CID 113204473) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 1,3-dimethyl-N-quinolin-8-ylindole-2-carboxamide.
| Compound Name | 1,3-dimethyl-N-quinolin-8-ylindole-2-carboxamide |
|---|---|
| PubChem CID | 113204473 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1,3-dimethyl-N-quinolin-8-ylindole-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc3cccnc23)n(C)c2ccccc12 |
| InChI | InChI=1S/C20H17N3O/c1-13-15-9-3-4-11-17(15)23(2)19(13)20(24)22-16-10-5-7-14-8-6-12-21-18(14)16/h3-12H,1-2H3,(H,22,24) |
| InChIKey | LCGXTLWUXOHCKM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|