C24H16N4O2S — CID 23913298
2-N,5-N-di(quinolin-8-yl)thiophene-2,5-dicarboxamide (PubChem CID 23913298) has the molecular formula C24H16N4O2S and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-N,5-N-di(quinolin-8-yl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-di(quinolin-8-yl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 23913298 |
| Molecular Formula | C24H16N4O2S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-N,5-N-di(quinolin-8-yl)thiophene-2,5-dicarboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1ccc(C(=O)Nc2cccc3cccnc23)s1 |
| InChI | InChI=1S/C24H16N4O2S/c29-23(27-17-9-1-5-15-7-3-13-25-21(15)17)19-11-12-20(31-19)24(30)28-18-10-2-6-16-8-4-14-26-22(16)18/h1-14H,(H,27,29)(H,28,30) |
| InChIKey | KJUJOJSRFCYADY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |