C21H16N4O2S — CID 78846872
5-(phenylcarbamoylamino)-N-quinolin-8-ylthiophene-2-carboxamide (PubChem CID 78846872) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is 5-(phenylcarbamoylamino)-N-quinolin-8-ylthiophene-2-carboxamide.
| Compound Name | 5-(phenylcarbamoylamino)-N-quinolin-8-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78846872 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 5-(phenylcarbamoylamino)-N-quinolin-8-ylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)Nc2cccc3cccnc23)s1 |
| InChI | InChI=1S/C21H16N4O2S/c26-20(24-16-10-4-6-14-7-5-13-22-19(14)16)17-11-12-18(28-17)25-21(27)23-15-8-2-1-3-9-15/h1-13H,(H,24,26)(H2,23,25,27) |
| InChIKey | IONSZBJNDXEIHO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |