C19H17N3O2S2 — CID 78846361
N-(2-methylsulfanylphenyl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide (PubChem CID 78846361) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide.
| Compound Name | N-(2-methylsulfanylphenyl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78846361 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
| SMILES | CSc1ccccc1NC(=O)c1ccc(NC(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C19H17N3O2S2/c1-25-15-10-6-5-9-14(15)21-18(23)16-11-12-17(26-16)22-19(24)20-13-7-3-2-4-8-13/h2-12H,1H3,(H,21,23)(H2,20,22,24) |
| InChIKey | BXSSPWGQPNGUJL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |