C16H18N4O4S — CID 86806417
1-[5-[[(2-hydroxy-2-methylpropanoyl)amino]carbamoyl]thiophen-2-yl]-3-phenylurea (PubChem CID 86806417) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-[5-[[(2-hydroxy-2-methylpropanoyl)amino]carbamoyl]thiophen-2-yl]-3-phenylurea.
| Compound Name | 1-[5-[[(2-hydroxy-2-methylpropanoyl)amino]carbamoyl]thiophen-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 86806417 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[5-[[(2-hydroxy-2-methylpropanoyl)amino]carbamoyl]thiophen-2-yl]-3-phenylurea |
| SMILES | CC(C)(O)C(=O)NNC(=O)c1ccc(NC(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C16H18N4O4S/c1-16(2,24)14(22)20-19-13(21)11-8-9-12(25-11)18-15(23)17-10-6-4-3-5-7-10/h3-9,24H,1-2H3,(H,19,21)(H,20,22)(H2,17,18,23) |
| InChIKey | NLJLABQBQDYQEC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|