C22H22N4O3S — CID 78850259
N-[[4-(dimethylcarbamoyl)phenyl]methyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide (PubChem CID 78850259) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[[4-(dimethylcarbamoyl)phenyl]methyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide.
| Compound Name | N-[[4-(dimethylcarbamoyl)phenyl]methyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78850259 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[[4-(dimethylcarbamoyl)phenyl]methyl]-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(CNC(=O)c2ccc(NC(=O)Nc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-26(2)21(28)16-10-8-15(9-11-16)14-23-20(27)18-12-13-19(30-18)25-22(29)24-17-6-4-3-5-7-17/h3-13H,14H2,1-2H3,(H,23,27)(H2,24,25,29) |
| InChIKey | WJIIQJBYAIIGTM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |