C15H16N2O3S — CID 107232601
5-acetamido-N-[[4-(hydroxymethyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 107232601) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-acetamido-N-[[4-(hydroxymethyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-acetamido-N-[[4-(hydroxymethyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 107232601 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-acetamido-N-[[4-(hydroxymethyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NCc2ccc(CO)cc2)s1 |
| InChI | InChI=1S/C15H16N2O3S/c1-10(19)17-14-7-6-13(21-14)15(20)16-8-11-2-4-12(9-18)5-3-11/h2-7,18H,8-9H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | LSGJYJIJNIWKJK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |