C18H23N3O4S2 — CID 24610904
5-acetamido-N-[[4-(diethylsulfamoyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 24610904) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 5-acetamido-N-[[4-(diethylsulfamoyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-acetamido-N-[[4-(diethylsulfamoyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24610904 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 5-acetamido-N-[[4-(diethylsulfamoyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)c2ccc(NC(C)=O)s2)cc1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-4-21(5-2)27(24,25)15-8-6-14(7-9-15)12-19-18(23)16-10-11-17(26-16)20-13(3)22/h6-11H,4-5,12H2,1-3H3,(H,19,23)(H,20,22) |
| InChIKey | AIJLPJYBFXWJTO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |