C20H19N3O3S — CID 78846484
N-(2-phenoxyethyl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide (PubChem CID 78846484) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide.
| Compound Name | N-(2-phenoxyethyl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78846484 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-(2-phenoxyethyl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)NCCOc2ccccc2)s1 |
| InChI | InChI=1S/C20H19N3O3S/c24-19(21-13-14-26-16-9-5-2-6-10-16)17-11-12-18(27-17)23-20(25)22-15-7-3-1-4-8-15/h1-12H,13-14H2,(H,21,24)(H2,22,23,25) |
| InChIKey | JNRPDSFTVKPQAT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|