C16H19N3O3S — CID 78849139
N-(1-methoxypropan-2-yl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide (PubChem CID 78849139) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide.
| Compound Name | N-(1-methoxypropan-2-yl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78849139 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-5-(phenylcarbamoylamino)thiophene-2-carboxamide |
| SMILES | COCC(C)NC(=O)c1ccc(NC(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C16H19N3O3S/c1-11(10-22-2)17-15(20)13-8-9-14(23-13)19-16(21)18-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,17,20)(H2,18,19,21) |
| InChIKey | SXPOGARTQCDLSZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |