C15H13NO3S2 — CID 107642897
(E)-3-[5-[(2-methylsulfanylphenyl)carbamoyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 107642897) has the molecular formula C15H13NO3S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is (E)-3-[5-[(2-methylsulfanylphenyl)carbamoyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(2-methylsulfanylphenyl)carbamoyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107642897 |
| Molecular Formula | C15H13NO3S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | (E)-3-[5-[(2-methylsulfanylphenyl)carbamoyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CSc1ccccc1NC(=O)c1ccc(/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C15H13NO3S2/c1-20-12-5-3-2-4-11(12)16-15(19)13-8-6-10(21-13)7-9-14(17)18/h2-9H,1H3,(H,16,19)(H,17,18)/b9-7+ |
| InChIKey | AWXMHJZZWKHOJT-VQHVLOKHSA-N |
| XLogP | 3.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|