C21H15N3O2S — CID 27990641
N-[3-(quinolin-8-ylcarbamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 27990641) has the molecular formula C21H15N3O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[3-(quinolin-8-ylcarbamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(quinolin-8-ylcarbamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27990641 |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[3-(quinolin-8-ylcarbamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H15N3O2S/c25-20(24-17-9-2-5-14-7-3-11-22-19(14)17)15-6-1-8-16(13-15)23-21(26)18-10-4-12-27-18/h1-13H,(H,23,26)(H,24,25) |
| InChIKey | ULSDEAHENLQNKE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |