C19H14FN3O3S — CID 166217861
N-[3-[(4-carbamoyl-2-fluorophenyl)carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 166217861) has the molecular formula C19H14FN3O3S and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[3-[(4-carbamoyl-2-fluorophenyl)carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(4-carbamoyl-2-fluorophenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 166217861 |
| Molecular Formula | C19H14FN3O3S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[3-[(4-carbamoyl-2-fluorophenyl)carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2cccc(NC(=O)c3cccs3)c2)c(F)c1 |
| InChI | InChI=1S/C19H14FN3O3S/c20-14-10-11(17(21)24)6-7-15(14)23-18(25)12-3-1-4-13(9-12)22-19(26)16-5-2-8-27-16/h1-10H,(H2,21,24)(H,22,26)(H,23,25) |
| InChIKey | CKQCZTRPHGKATR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |